5-[(2,6-Dichlorophenoxy)methyl]-2-furancarboxylic acid hydrazide structure
|
Common Name | 5-[(2,6-Dichlorophenoxy)methyl]-2-furancarboxylic acid hydrazide | ||
|---|---|---|---|---|
| CAS Number | 861237-86-7 | Molecular Weight | 301.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10Cl2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-[(2,6-Dichlorophenoxy)methyl]-2-furancarboxylic acid hydrazide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H10Cl2N2O3 |
|---|---|
| Molecular Weight | 301.12 |
| InChIKey | NDDQHTGNAICSJY-UHFFFAOYSA-N |
| SMILES | NNC(=O)c1ccc(COc2c(Cl)cccc2Cl)o1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 5-[(2,6-Dichlorophenoxy)methyl]-2-furancarboxylic acid hydrazide? |
| A: CAS number of 5-[(2,6-Dichlorophenoxy)methyl]-2-furancarboxylic acid hydrazide is 861237-86-7. |
| Q: What is the English name of 5-[(2,6-Dichlorophenoxy)methyl]-2-furancarboxylic acid hydrazide? |
| A: The English name of 5-[(2,6-Dichlorophenoxy)methyl]-2-furancarboxylic acid hydrazide is 5-[(2,6-Dichlorophenoxy)methyl]-2-furancarboxylic acid hydrazide. |
| Q: What is the Chinese name of 861237-86-7? |
| A: Chinese name of 861237-86-7 is 861237-86-7. |
| Q: What is the molecular formula of 5-[(2,6-Dichlorophenoxy)methyl]-2-furancarboxylic acid hydrazide? |
| A: Molecular formula of 5-[(2,6-Dichlorophenoxy)methyl]-2-furancarboxylic acid hydrazide is C12H10Cl2N2O3. |
| Q: What is the SMILES notation of 5-[(2,6-Dichlorophenoxy)methyl]-2-furancarboxylic acid hydrazide? |
| A: SMILES notation of 5-[(2,6-Dichlorophenoxy)methyl]-2-furancarboxylic acid hydrazide is NNC(=O)c1ccc(COc2c(Cl)cccc2Cl)o1. |
| Q: What is the InChIKey of 5-[(2,6-Dichlorophenoxy)methyl]-2-furancarboxylic acid hydrazide? |
| A: InChIKey of 5-[(2,6-Dichlorophenoxy)methyl]-2-furancarboxylic acid hydrazide is NDDQHTGNAICSJY-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 5-[(2,6-Dichlorophenoxy)methyl]-2-furancarboxylic acid hydrazide? |
| A: Molecular weight of 5-[(2,6-Dichlorophenoxy)methyl]-2-furancarboxylic acid hydrazide is 301.12. |