1,8-bis(methylsulfanyl)anthracene-9,10-dione structure
|
Common Name | 1,8-bis(methylsulfanyl)anthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 861527-45-9 | Molecular Weight | 300.39500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,8-bis(methylsulfanyl)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12O2S2 |
|---|---|
| Molecular Weight | 300.39500 |
| Exact Mass | 300.02800 |
| PSA | 84.74000 |
| LogP | 3.90580 |
| InChIKey | MZGPJUXQIWARCS-UHFFFAOYSA-N |
| SMILES | CSc1cccc2c1C(=O)c1c(SC)cccc1C2=O |
|
~23%
1,8-bis(methyls... CAS#:861527-45-9 |
| Literature: Nakanishi, Waro; Nakamoto, Takashi; Hayashi, Satoko; Sasamori, Takahiro; Tokitoh, Norihiro Chemistry - A European Journal, 2007 , vol. 13, # 1 p. 255 - 268 |
|
~%
1,8-bis(methyls... CAS#:861527-45-9 |
| Literature: Reid; Mackall; Miller Journal of the American Chemical Society, 1921 , vol. 43, p. 2115 |
| 1,8-Bis-methylmercapto-anthrachinon |
| 1,8-bis-methylsulfanyl-anthraquinone |
| 1,8-bis(methylthio)anthraquinone |
| 9,10-Anthracenedione,1,8-bis(methylthio) |