2-(Hexanoylamino)-3,5-diiodobenzoic acid
2-(Hexanoylamino)-3,5-diiodobenzoic acid structure
|
Common Name | 2-(Hexanoylamino)-3,5-diiodobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 86166-38-3 | Molecular Weight | 487.07200 | |
| Density | 1.986g/cm3 | Boiling Point | 545.9ºC at 760 mmHg | |
| Molecular Formula | C13H15I2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(Hexanoylamino)-3,5-diiodobenzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.986g/cm3 |
|---|---|
| Boiling Point | 545.9ºC at 760 mmHg |
| Molecular Formula | C13H15I2NO3 |
| Molecular Weight | 487.07200 |
| Flash Point | 284ºC |
| Exact Mass | 486.91400 |
| PSA | 69.89000 |
| LogP | 4.76230 |
| Index of Refraction | 1.671 |
| InChIKey | JIWNGRQDPJTDAQ-UHFFFAOYSA-N |
| SMILES | CCCCCC(=O)Nc1c(I)cc(I)cc1C(=O)O |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-(Hexanoylamin... CAS#:86166-38-3 |
| Literature: Wallingford et al. Journal of the American Chemical Society, 1952 , vol. 74, p. 4365,4366 |
|
~%
2-(Hexanoylamin... CAS#:86166-38-3 |
| Literature: Wallingford et al. Journal of the American Chemical Society, 1952 , vol. 74, p. 4365,4366 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,5-Diiodo-N-hexanoylanthranilic acid |
| 2-hexanoylamino-3,5-diiodo-benzoic acid |
| 2-Hexanoylamino-3,5-dijod-benzoesaeure |
| Anthranilic acid,3,5-diiodo-N-hexanoyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-(Hexanoylamino)-3,5-diiodobenzoic acid? |
| A: The English name of 2-(Hexanoylamino)-3,5-diiodobenzoic acid is 2-(Hexanoylamino)-3,5-diiodobenzoic acid. |
| Q: What is the molecular weight of 2-(Hexanoylamino)-3,5-diiodobenzoic acid? |
| A: Molecular weight of 2-(Hexanoylamino)-3,5-diiodobenzoic acid is 487.07200. |
| Q: What is the molecular formula of 2-(Hexanoylamino)-3,5-diiodobenzoic acid? |
| A: Molecular formula of 2-(Hexanoylamino)-3,5-diiodobenzoic acid is C13H15I2NO3. |
| Q: What is the boiling point of 2-(Hexanoylamino)-3,5-diiodobenzoic acid? |
| A: Boiling point of 2-(Hexanoylamino)-3,5-diiodobenzoic acid is 545.9ºC at 760 mmHg. |
| Q: What is the InChIKey of 2-(Hexanoylamino)-3,5-diiodobenzoic acid? |
| A: InChIKey of 2-(Hexanoylamino)-3,5-diiodobenzoic acid is JIWNGRQDPJTDAQ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-(Hexanoylamino)-3,5-diiodobenzoic acid? |
| A: CAS number of 2-(Hexanoylamino)-3,5-diiodobenzoic acid is 86166-38-3. |
| Q: What is the polar surface area (PSA) of 2-(Hexanoylamino)-3,5-diiodobenzoic acid? |
| A: Polar surface area (PSA) of 2-(Hexanoylamino)-3,5-diiodobenzoic acid is 69.89000. |
| Q: What English synonyms does 2-(Hexanoylamino)-3,5-diiodobenzoic acid have? |
| A: English synonyms of 2-(Hexanoylamino)-3,5-diiodobenzoic acid: 3,5-Diiodo-N-hexanoylanthranilic acid, 2-hexanoylamino-3,5-diiodo-benzoic acid, 2-Hexanoylamino-3,5-dijod-benzoesaeure, Anthranilic acid,3,5-diiodo-N-hexanoyl. |
| Q: What is the SMILES notation of 2-(Hexanoylamino)-3,5-diiodobenzoic acid? |
| A: SMILES notation of 2-(Hexanoylamino)-3,5-diiodobenzoic acid is CCCCCC(=O)Nc1c(I)cc(I)cc1C(=O)O. |
| Q: What is the Chinese name of 86166-38-3? |
| A: Chinese name of 86166-38-3 is 86166-38-3. |