2-(Trimethylsilyl)ethyl 3-methylcyclohexanecarboxylate
Modify Date: 2025-08-21 20:38:54
2-(Trimethylsilyl)ethyl 3-methylcyclohexanecarboxylate structure
|
Common Name | 2-(Trimethylsilyl)ethyl 3-methylcyclohexanecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 861858-86-8 | Molecular Weight | 242.43 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H26O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(Trimethylsilyl)ethyl 3-methylcyclohexanecarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H26O2Si |
|---|---|
| Molecular Weight | 242.43 |
| InChIKey | SFIPDSFPPMANIF-UHFFFAOYSA-N |
| SMILES | CC1CCCC(C(=O)OCC[Si](C)(C)C)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 861858-86-8? |
| A: Chinese name of 861858-86-8 is 861858-86-8. |
| Q: What is the CAS number of 2-(Trimethylsilyl)ethyl 3-methylcyclohexanecarboxylate? |
| A: CAS number of 2-(Trimethylsilyl)ethyl 3-methylcyclohexanecarboxylate is 861858-86-8. |
| Q: What is the English name of 2-(Trimethylsilyl)ethyl 3-methylcyclohexanecarboxylate? |
| A: The English name of 2-(Trimethylsilyl)ethyl 3-methylcyclohexanecarboxylate is 2-(Trimethylsilyl)ethyl 3-methylcyclohexanecarboxylate. |
| Q: What is the molecular weight of 2-(Trimethylsilyl)ethyl 3-methylcyclohexanecarboxylate? |
| A: Molecular weight of 2-(Trimethylsilyl)ethyl 3-methylcyclohexanecarboxylate is 242.43. |
| Q: What is the SMILES notation of 2-(Trimethylsilyl)ethyl 3-methylcyclohexanecarboxylate? |
| A: SMILES notation of 2-(Trimethylsilyl)ethyl 3-methylcyclohexanecarboxylate is CC1CCCC(C(=O)OCC[Si](C)(C)C)C1. |
| Q: What is the InChIKey of 2-(Trimethylsilyl)ethyl 3-methylcyclohexanecarboxylate? |
| A: InChIKey of 2-(Trimethylsilyl)ethyl 3-methylcyclohexanecarboxylate is SFIPDSFPPMANIF-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-(Trimethylsilyl)ethyl 3-methylcyclohexanecarboxylate? |
| A: Molecular formula of 2-(Trimethylsilyl)ethyl 3-methylcyclohexanecarboxylate is C13H26O2Si. |