Benzenesulfonamide,4-[(3,5-dimethyl-1-phenyl-1h-pyrazol-4-yl)azo]-n-phenyl
Modify Date: 2026-08-23 17:41:24
![Benzenesulfonamide,4-[(3,5-dimethyl-1-phenyl-1h-pyrazol-4-yl)azo]-n-phenyl Structure](https://www.chemsrc.com/extcaspic/062/862-65-7.png)
Benzenesulfonamide,4-[(3,5-dimethyl-1-phenyl-1h-pyrazol-4-yl)azo]-n-phenyl structure
|
Common Name | Benzenesulfonamide,4-[(3,5-dimethyl-1-phenyl-1h-pyrazol-4-yl)azo]-n-phenyl | ||
|---|---|---|---|---|
| CAS Number | 862-65-7 | Molecular Weight | 431.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H21N5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzenesulfonamide,4-[(3,5-dimethyl-1-phenyl-1h-pyrazol-4-yl)azo]-n-phenyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H21N5O2S |
|---|---|
| Molecular Weight | 431.5 |
| InChIKey | PSSFBJDEFDLFQC-UHFFFAOYSA-N |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1N=Nc1ccc(S(=O)(=O)Nc2ccccc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Benzenesulfonamide,4-[(3,5-dimethyl-1-phenyl-1h-pyrazol-4-yl)azo]-n-phenyl? |
| A: Molecular weight of Benzenesulfonamide,4-[(3,5-dimethyl-1-phenyl-1h-pyrazol-4-yl)azo]-n-phenyl is 431.5. |
| Q: What is the SMILES notation of Benzenesulfonamide,4-[(3,5-dimethyl-1-phenyl-1h-pyrazol-4-yl)azo]-n-phenyl? |
| A: SMILES notation of Benzenesulfonamide,4-[(3,5-dimethyl-1-phenyl-1h-pyrazol-4-yl)azo]-n-phenyl is Cc1nn(-c2ccccc2)c(C)c1N=Nc1ccc(S(=O)(=O)Nc2ccccc2)cc1. |
| Q: What is the InChIKey of Benzenesulfonamide,4-[(3,5-dimethyl-1-phenyl-1h-pyrazol-4-yl)azo]-n-phenyl? |
| A: InChIKey of Benzenesulfonamide,4-[(3,5-dimethyl-1-phenyl-1h-pyrazol-4-yl)azo]-n-phenyl is PSSFBJDEFDLFQC-UHFFFAOYSA-N. |
| Q: What is the CAS number of Benzenesulfonamide,4-[(3,5-dimethyl-1-phenyl-1h-pyrazol-4-yl)azo]-n-phenyl? |
| A: CAS number of Benzenesulfonamide,4-[(3,5-dimethyl-1-phenyl-1h-pyrazol-4-yl)azo]-n-phenyl is 862-65-7. |
| Q: What is the molecular formula of Benzenesulfonamide,4-[(3,5-dimethyl-1-phenyl-1h-pyrazol-4-yl)azo]-n-phenyl? |
| A: Molecular formula of Benzenesulfonamide,4-[(3,5-dimethyl-1-phenyl-1h-pyrazol-4-yl)azo]-n-phenyl is C23H21N5O2S. |
| Q: What is the Chinese name of 862-65-7? |
| A: Chinese name of 862-65-7 is 862-65-7. |
| Q: What is the English name of Benzenesulfonamide,4-[(3,5-dimethyl-1-phenyl-1h-pyrazol-4-yl)azo]-n-phenyl? |
| A: The English name of Benzenesulfonamide,4-[(3,5-dimethyl-1-phenyl-1h-pyrazol-4-yl)azo]-n-phenyl is Benzenesulfonamide,4-[(3,5-dimethyl-1-phenyl-1h-pyrazol-4-yl)azo]-n-phenyl. |