16R-Hydroxy-3-oxolanosta7,9(11),24-trien-21-oic acid structure
|
Common Name | 16R-Hydroxy-3-oxolanosta7,9(11),24-trien-21-oic acid | ||
|---|---|---|---|---|
| CAS Number | 862109-64-6 | Molecular Weight | 468.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H44O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 16R-Hydroxy-3-oxolanosta7,9(11),24-trien-21-oic acid16R-Hydroxy-3-oxolanosta7,9(11),24-trien-21-oic acid is a lanostanoid that can be found in the Sri Lankan basidiomycete Ganoderma applanatum[1]. |
| Name | 16R-Hydroxy-3-oxolanosta7,9(11),24-trien-21-oic acid |
|---|
| Description | 16R-Hydroxy-3-oxolanosta7,9(11),24-trien-21-oic acid is a lanostanoid that can be found in the Sri Lankan basidiomycete Ganoderma applanatum[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C30H44O4 |
|---|---|
| Molecular Weight | 468.67 |
| InChIKey | LVYOXPQJURJWPC-MVQHSHHOSA-N |
| SMILES | CC(C)=CCCC(C(=O)O)C1C(O)CC2(C)C3=CCC4C(C)(C)C(=O)CCC4(C)C3=CCC12C |