(9,9-Dimethyl-9H-xanthene-4,5-diyl)diboronic acid
(9,9-Dimethyl-9H-xanthene-4,5-diyl)diboronic acid structure
|
Common Name | (9,9-Dimethyl-9H-xanthene-4,5-diyl)diboronic acid | ||
|---|---|---|---|---|
| CAS Number | 862159-27-1 | Molecular Weight | 297.90700 | |
| Density | 1.35g/cm3 | Boiling Point | 561.7ºC at 760 mmHg | |
| Molecular Formula | C15H16B2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (9,9-Dimethyl-9H-xanthene-4,5-diyl)diboronic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 561.7ºC at 760 mmHg |
| Molecular Formula | C15H16B2O5 |
| Molecular Weight | 297.90700 |
| Flash Point | 293.5ºC |
| Exact Mass | 298.11800 |
| PSA | 90.15000 |
| Index of Refraction | 1.631 |
| InChIKey | BXWZPWDOAASIEC-UHFFFAOYSA-N |
| SMILES | CC1(C)c2cccc(B(O)O)c2Oc2c(B(O)O)cccc21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~93%
(9,9-Dimethyl-9... CAS#:862159-27-1 |
| Literature: Saito, Shinichi; Yamaguchi, Hiromitsu; Muto, Hiroki; Makino, Takeshi Tetrahedron Letters, 2007 , vol. 48, # 42 p. 7498 - 7501 |
|
~70%
(9,9-Dimethyl-9... CAS#:862159-27-1 |
| Literature: Hirotsu, Masakazu; Ohno, Naoki; Nakajima, Takashi; Kushibe, Chie; Ueno, Keiji; Kinoshita, Isamu Dalton Transactions, 2010 , vol. 39, # 1 p. 139 - 148 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 9,9-dimethyl-9H-xanthene-4,5-diyldiboronic acid |
| 9,9'-dimethylxanthene |
| 9,9-dimethylxanthane |
| 9,9-dimethylxanthene-4,5-diboronic acid |
| xanthenediboronic acid |
| 9,9-Dimethylxantene |
| 9,9-Dimethyl-9H-xanthene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does (9,9-Dimethyl-9H-xanthene-4,5-diyl)diboronic acid have? |
| A: English synonyms of (9,9-Dimethyl-9H-xanthene-4,5-diyl)diboronic acid: 9,9-dimethyl-9H-xanthene-4,5-diyldiboronic acid, 9,9'-dimethylxanthene, 9,9-dimethylxanthane, 9,9-dimethylxanthene-4,5-diboronic acid, xanthenediboronic acid, 9,9-Dimethylxantene, 9,9-Dimethyl-9H-xanthene. |
| Q: What is the English name of (9,9-Dimethyl-9H-xanthene-4,5-diyl)diboronic acid? |
| A: The English name of (9,9-Dimethyl-9H-xanthene-4,5-diyl)diboronic acid is (9,9-Dimethyl-9H-xanthene-4,5-diyl)diboronic acid. |
| Q: What is the InChIKey of (9,9-Dimethyl-9H-xanthene-4,5-diyl)diboronic acid? |
| A: InChIKey of (9,9-Dimethyl-9H-xanthene-4,5-diyl)diboronic acid is BXWZPWDOAASIEC-UHFFFAOYSA-N. |
| Q: What is the molecular weight of (9,9-Dimethyl-9H-xanthene-4,5-diyl)diboronic acid? |
| A: Molecular weight of (9,9-Dimethyl-9H-xanthene-4,5-diyl)diboronic acid is 297.90700. |
| Q: What is the SMILES notation of (9,9-Dimethyl-9H-xanthene-4,5-diyl)diboronic acid? |
| A: SMILES notation of (9,9-Dimethyl-9H-xanthene-4,5-diyl)diboronic acid is CC1(C)c2cccc(B(O)O)c2Oc2c(B(O)O)cccc21. |
| Q: What is the polar surface area (PSA) of (9,9-Dimethyl-9H-xanthene-4,5-diyl)diboronic acid? |
| A: Polar surface area (PSA) of (9,9-Dimethyl-9H-xanthene-4,5-diyl)diboronic acid is 90.15000. |
| Q: What is the molecular formula of (9,9-Dimethyl-9H-xanthene-4,5-diyl)diboronic acid? |
| A: Molecular formula of (9,9-Dimethyl-9H-xanthene-4,5-diyl)diboronic acid is C15H16B2O5. |
| Q: What is the CAS number of (9,9-Dimethyl-9H-xanthene-4,5-diyl)diboronic acid? |
| A: CAS number of (9,9-Dimethyl-9H-xanthene-4,5-diyl)diboronic acid is 862159-27-1. |
| Q: What is the boiling point of (9,9-Dimethyl-9H-xanthene-4,5-diyl)diboronic acid? |
| A: Boiling point of (9,9-Dimethyl-9H-xanthene-4,5-diyl)diboronic acid is 561.7ºC at 760 mmHg. |