benzyl 2-(3-oxocyclobutyl)acetate structure
|
Common Name | benzyl 2-(3-oxocyclobutyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 862307-21-9 | Molecular Weight | 218.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzyl 2-(3-oxocyclobutyl)acetate |
|---|
| Molecular Formula | C13H14O3 |
|---|---|
| Molecular Weight | 218.24800 |
| Exact Mass | 218.09400 |
| PSA | 43.37000 |
| LogP | 2.09900 |
| InChIKey | RUQBTZJNUJTCLL-UHFFFAOYSA-N |
| SMILES | O=C1CC(CC(=O)OCc2ccccc2)C1 |
| HS Code | 2918300090 |
|---|
|
~79%
benzyl 2-(3-oxo... CAS#:862307-21-9 |
| Literature: De Blieck, Ann; Stevens, Christian V. Synlett, 2011 , # 12 p. 1748 - 1752 |
|
~%
benzyl 2-(3-oxo... CAS#:862307-21-9 |
| Literature: Kabalka, George W.; Yao, Min-Liang; Navarane, Abhijit Tetrahedron Letters, 2005 , vol. 46, # 29 p. 4915 - 4917 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |