N,N-diethyl-N,N-diphenyl-ethane-1,1-disulfonamide structure
|
Common Name | N,N-diethyl-N,N-diphenyl-ethane-1,1-disulfonamide | ||
|---|---|---|---|---|
| CAS Number | 86232-17-9 | Molecular Weight | 396.52400 | |
| Density | 1.313g/cm3 | Boiling Point | 533.5ºC at 760 mmHg | |
| Molecular Formula | C18H24N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.5ºC | |
| Name | 1-N,1-N'-diethyl-1-N,1-N'-diphenylethane-1,1-disulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.313g/cm3 |
|---|---|
| Boiling Point | 533.5ºC at 760 mmHg |
| Molecular Formula | C18H24N2O4S2 |
| Molecular Weight | 396.52400 |
| Flash Point | 276.5ºC |
| Exact Mass | 396.11800 |
| PSA | 91.52000 |
| LogP | 5.20660 |
| Index of Refraction | 1.61 |
| InChIKey | OCHKSXBFMDCBNV-UHFFFAOYSA-N |
| SMILES | CCN(c1ccccc1)S(=O)(=O)C(C)S(=O)(=O)N(CC)c1ccccc1 |
|
~%
N,N-diethyl-N,N... CAS#:86232-17-9 |
| Literature: Rochnyak, O. E.; Lutsenko, L. N.; Boldyrev,B. G. Journal of Organic Chemistry USSR (English Translation), 1983 , vol. 19, p. 504 - 506 Zhurnal Organicheskoi Khimii, 1983 , vol. 19, # 3 p. 572 - 575 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Methylmethionsaeure-bis-aethylanilid |
| N,N'-Diaethyl-N,N'-diphenyl-aethan-1,1-disulfonamid |
| N,N'-diethyl-N,N'-diphenyl-ethane-1,1-disulfonamide |