methyl 4-(3-oxo-3-phenyl-propanoyl)benzoate structure
|
Common Name | methyl 4-(3-oxo-3-phenyl-propanoyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 86235-82-7 | Molecular Weight | 282.29100 | |
| Density | 1.202g/cm3 | Boiling Point | 461.7ºC at 760 mmHg | |
| Molecular Formula | C17H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.9ºC | |
| Name | methyl 4-(3-oxo-3-phenylpropanoyl)benzoate |
|---|
| Density | 1.202g/cm3 |
|---|---|
| Boiling Point | 461.7ºC at 760 mmHg |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.29100 |
| Flash Point | 205.9ºC |
| Exact Mass | 282.08900 |
| PSA | 60.44000 |
| LogP | 2.92890 |
| Index of Refraction | 1.575 |
| InChIKey | LRMYWDOAJZQFJQ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C(=O)CC(=O)c2ccccc2)cc1 |
|
~%
methyl 4-(3-oxo... CAS#:86235-82-7 |
| Literature: Nakatani, Kazuhiko; Shirai, Junya; Sando, Shinsuke; Saito, Isao Journal of the American Chemical Society, 1997 , vol. 119, # 33 p. 7626 - 7635 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |