4'-BROMO-2-CHLOROCHALCONE structure
|
Common Name | 4'-BROMO-2-CHLOROCHALCONE | ||
|---|---|---|---|---|
| CAS Number | 86293-48-3 | Molecular Weight | 321.59600 | |
| Density | 1.475g/cm3 | Boiling Point | 432.2ºC at 760 mmHg | |
| Molecular Formula | C15H10BrClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.2ºC | |
| Name | 1-(4-bromophenyl)-3-(2-chlorophenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.475g/cm3 |
|---|---|
| Boiling Point | 432.2ºC at 760 mmHg |
| Molecular Formula | C15H10BrClO |
| Molecular Weight | 321.59600 |
| Flash Point | 215.2ºC |
| Exact Mass | 319.96000 |
| PSA | 17.07000 |
| LogP | 4.99860 |
| Index of Refraction | 1.652 |
| InChIKey | BEAOMTXVYPADSY-UHFFFAOYSA-N |
| SMILES | O=C(C=Cc1ccccc1Cl)c1ccc(Br)cc1 |
| HS Code | 2914700090 |
|---|
|
~%
4'-BROMO-2-CHLO... CAS#:86293-48-3 |
| Literature: Davey; Gwilt Journal of the Chemical Society, 1957 , p. 1015 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4'-Bromo-2-chlorochalcone |
| 4'-bromo-2-chloro-trans-chalcone |
| 4'-Brom-2-chlor-trans-chalkon |
| 1-(4-bromophenyl)-3-(2-chlorophenyl)-2-propen-1-one |
| 2-Propen-1-one,1-(4-bromophenyl)-3-(2-chlorophenyl)-,(2E) |