benzyl (2S)-4-{[(tert-butoxy)carbonyl]amino}-2-hydroxybutanoate
Modify Date: 2025-09-09 17:47:04
![benzyl (2S)-4-{[(tert-butoxy)carbonyl]amino}-2-hydroxybutanoate Structure](https://www.chemsrc.com/extcaspic/107/863000-06-0.png)
benzyl (2S)-4-{[(tert-butoxy)carbonyl]amino}-2-hydroxybutanoate structure
|
Common Name | benzyl (2S)-4-{[(tert-butoxy)carbonyl]amino}-2-hydroxybutanoate | ||
|---|---|---|---|---|
| CAS Number | 863000-06-0 | Molecular Weight | 309.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H23NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl (2S)-4-{[(tert-butoxy)carbonyl]amino}-2-hydroxybutanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H23NO5 |
|---|---|
| Molecular Weight | 309.36 |
| InChIKey | CJINLCGMMLZQQV-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)NCCC(O)C(=O)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of benzyl (2S)-4-{[(tert-butoxy)carbonyl]amino}-2-hydroxybutanoate? |
| A: SMILES notation of benzyl (2S)-4-{[(tert-butoxy)carbonyl]amino}-2-hydroxybutanoate is CC(C)(C)OC(=O)NCCC(O)C(=O)OCc1ccccc1. |
| Q: What is the Chinese name of 863000-06-0? |
| A: Chinese name of 863000-06-0 is 863000-06-0. |
| Q: What is the molecular formula of benzyl (2S)-4-{[(tert-butoxy)carbonyl]amino}-2-hydroxybutanoate? |
| A: Molecular formula of benzyl (2S)-4-{[(tert-butoxy)carbonyl]amino}-2-hydroxybutanoate is C16H23NO5. |
| Q: What is the InChIKey of benzyl (2S)-4-{[(tert-butoxy)carbonyl]amino}-2-hydroxybutanoate? |
| A: InChIKey of benzyl (2S)-4-{[(tert-butoxy)carbonyl]amino}-2-hydroxybutanoate is CJINLCGMMLZQQV-ZDUSSCGKSA-N. |
| Q: What is the English name of benzyl (2S)-4-{[(tert-butoxy)carbonyl]amino}-2-hydroxybutanoate? |
| A: The English name of benzyl (2S)-4-{[(tert-butoxy)carbonyl]amino}-2-hydroxybutanoate is benzyl (2S)-4-{[(tert-butoxy)carbonyl]amino}-2-hydroxybutanoate. |
| Q: What is the molecular weight of benzyl (2S)-4-{[(tert-butoxy)carbonyl]amino}-2-hydroxybutanoate? |
| A: Molecular weight of benzyl (2S)-4-{[(tert-butoxy)carbonyl]amino}-2-hydroxybutanoate is 309.36. |
| Q: What is the CAS number of benzyl (2S)-4-{[(tert-butoxy)carbonyl]amino}-2-hydroxybutanoate? |
| A: CAS number of benzyl (2S)-4-{[(tert-butoxy)carbonyl]amino}-2-hydroxybutanoate is 863000-06-0. |