3-[2-(2,4-Dichlorophenoxy)phenyl]propanoic acid structure
|
Common Name | 3-[2-(2,4-Dichlorophenoxy)phenyl]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 86308-89-6 | Molecular Weight | 311.16000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[2-(2,4-Dichlorophenoxy)phenyl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H12Cl2O3 |
|---|---|
| Molecular Weight | 311.16000 |
| Exact Mass | 310.01600 |
| PSA | 46.53000 |
| LogP | 4.80290 |
| InChIKey | DDTJUXHTRMKODI-UHFFFAOYSA-N |
| SMILES | O=C(O)CCc1ccccc1Oc1ccc(Cl)cc1Cl |
| HS Code | 2918990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Potency relative to [2-(2,4-Dichloro-phenoxy)-phenyl]-acetic acid in rat adjuvant art...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL789241
|
|
Name: Reduction in paw swelling at 100 mg/kg po dose in rat using adjuvant arthritis test.
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL789170
|
| 3-[2-(2,4-dichlorophenoxy)phenyl]propionic acid |
| dichlorophenoxyphenylpropanoicacid |