1,3-Butanedione,1-(2-benzothiazolyl)-(9CI)
1,3-Butanedione,1-(2-benzothiazolyl)-(9CI) structure
|
Common Name | 1,3-Butanedione,1-(2-benzothiazolyl)-(9CI) | ||
|---|---|---|---|---|
| CAS Number | 86319-88-2 | Molecular Weight | 219.26000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-acetoacetylbenzothiazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H9NO2S |
|---|---|
| Molecular Weight | 219.26000 |
| Exact Mass | 219.03500 |
| PSA | 75.27000 |
| LogP | 2.45810 |
| InChIKey | GLBHDSPTUZOETI-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)c1nc2ccccc2s1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2934999090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:43193-11-9This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-acetoacetylbenzothiazole? |
| A: Molecular formula of 2-acetoacetylbenzothiazole is C11H9NO2S. |
| Q: What is the English name of 2-acetoacetylbenzothiazole? |
| A: The English name of 2-acetoacetylbenzothiazole is 2-acetoacetylbenzothiazole. |
| Q: What is the molecular weight of 2-acetoacetylbenzothiazole? |
| A: Molecular weight of 2-acetoacetylbenzothiazole is 219.26000. |
| Q: What is the polar surface area (PSA) of 2-acetoacetylbenzothiazole? |
| A: Polar surface area (PSA) of 2-acetoacetylbenzothiazole is 75.27000. |
| Q: What is the SMILES notation of 2-acetoacetylbenzothiazole? |
| A: SMILES notation of 2-acetoacetylbenzothiazole is CC(=O)CC(=O)c1nc2ccccc2s1. |
| Q: What is the InChIKey of 2-acetoacetylbenzothiazole? |
| A: InChIKey of 2-acetoacetylbenzothiazole is GLBHDSPTUZOETI-UHFFFAOYSA-N. |
| Q: What is the LogP of 2-acetoacetylbenzothiazole? |
| A: LogP of 2-acetoacetylbenzothiazole is 2.45810. |
| Q: What are the downstream products of 2-acetoacetylbenzothiazole? |
| A: Related downstream products(CAS) of 2-acetoacetylbenzothiazole: 43193-11-9. |
| Q: What is the CAS number of 2-acetoacetylbenzothiazole? |
| A: CAS number of 2-acetoacetylbenzothiazole is 86319-88-2. |
| Q: What is the Chinese name of 86319-88-2? |
| A: Chinese name of 86319-88-2 is 86319-88-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |