4-benzhydryl-5-methyl-1H-imidazole
4-benzhydryl-5-methyl-1H-imidazole structure
|
Common Name | 4-benzhydryl-5-methyl-1H-imidazole | ||
|---|---|---|---|---|
| CAS Number | 86347-10-6 | Molecular Weight | 248.32200 | |
| Density | 1.126g/cm3 | Boiling Point | 445ºC at 760 mmHg | |
| Molecular Formula | C17H16N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.3ºC | |
Summary: 4-Benzhydryl-5-methyl-1H-imidazole, Chinese name: 4-苯基-5-甲基咪唑, CAS number: 86347-10-6, molecular formula: C17H16N2, molecular weight: 248.32200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-benzhydryl-5-methyl-1H-imidazole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.126g/cm3 |
|---|---|
| Boiling Point | 445ºC at 760 mmHg |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.32200 |
| Flash Point | 231.3ºC |
| Exact Mass | 248.13100 |
| PSA | 28.68000 |
| LogP | 3.89830 |
| Index of Refraction | 1.618 |
| InChIKey | VNVJVZFATHMEQQ-UHFFFAOYSA-N |
| SMILES | Cc1[nH]cnc1C(c1ccccc1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-benzhydryl-4-methyl-1H-imidazole |
| Imidazole,4-(diphenyl)methyl-5-methyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 86347-10-6? |
| A: Chinese name of 86347-10-6 is 86347-10-6. |
| Q: What is the CAS number of 4-benzhydryl-5-methyl-1H-imidazole? |
| A: CAS number of 4-benzhydryl-5-methyl-1H-imidazole is 86347-10-6. |
| Q: What is the LogP of 4-benzhydryl-5-methyl-1H-imidazole? |
| A: LogP of 4-benzhydryl-5-methyl-1H-imidazole is 3.89830. |
| Q: What are the upstream materials of 4-benzhydryl-5-methyl-1H-imidazole? |
| A: Related upstream materials(CAS) of 4-benzhydryl-5-methyl-1H-imidazole: 68282-53-1;71-43-2. |
| Q: What is the boiling point of 4-benzhydryl-5-methyl-1H-imidazole? |
| A: Boiling point of 4-benzhydryl-5-methyl-1H-imidazole is 445ºC at 760 mmHg. |
| Q: What is the SMILES notation of 4-benzhydryl-5-methyl-1H-imidazole? |
| A: SMILES notation of 4-benzhydryl-5-methyl-1H-imidazole is Cc1[nH]cnc1C(c1ccccc1)c1ccccc1. |
| Q: What English synonyms does 4-benzhydryl-5-methyl-1H-imidazole have? |
| A: English synonyms of 4-benzhydryl-5-methyl-1H-imidazole: 5-benzhydryl-4-methyl-1H-imidazole, Imidazole,4-(diphenyl)methyl-5-methyl. |
| Q: What is the molecular formula of 4-benzhydryl-5-methyl-1H-imidazole? |
| A: Molecular formula of 4-benzhydryl-5-methyl-1H-imidazole is C17H16N2. |
| Q: What is the English name of 4-benzhydryl-5-methyl-1H-imidazole? |
| A: The English name of 4-benzhydryl-5-methyl-1H-imidazole is 4-benzhydryl-5-methyl-1H-imidazole. |
| Q: What is the InChIKey of 4-benzhydryl-5-methyl-1H-imidazole? |
| A: InChIKey of 4-benzhydryl-5-methyl-1H-imidazole is VNVJVZFATHMEQQ-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |