acetic acid,2-(chloromethoxy)propane-1,3-diol
acetic acid,2-(chloromethoxy)propane-1,3-diol structure
|
Common Name | acetic acid,2-(chloromethoxy)propane-1,3-diol | ||
|---|---|---|---|---|
| CAS Number | 86357-16-6 | Molecular Weight | 260.66900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H17ClO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | acetic acid,2-(chloromethoxy)propane-1,3-diol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H17ClO7 |
|---|---|
| Molecular Weight | 260.66900 |
| Exact Mass | 260.06600 |
| PSA | 124.29000 |
| InChIKey | RWNVHBCBGFNXKJ-UHFFFAOYSA-N |
| SMILES | CC(=O)O.CC(=O)O.OCC(CO)OCCl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
acetic acid,2-(... CAS#:86357-16-6 |
| Literature: Merck and Co., Inc. Patent: US4897479 A1, 1990 ; |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| chloromethyl 1,3-diacetoxy-2-propyl ether |
| 1,3-Propanediol,2-(chloromethoxy)-,diacetate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of acetic acid,2-(chloromethoxy)propane-1,3-diol? |
| A: Polar surface area (PSA) of acetic acid,2-(chloromethoxy)propane-1,3-diol is 124.29000. |
| Q: What is the molecular formula of acetic acid,2-(chloromethoxy)propane-1,3-diol? |
| A: Molecular formula of acetic acid,2-(chloromethoxy)propane-1,3-diol is C8H17ClO7. |
| Q: What is the English name of acetic acid,2-(chloromethoxy)propane-1,3-diol? |
| A: The English name of acetic acid,2-(chloromethoxy)propane-1,3-diol is acetic acid,2-(chloromethoxy)propane-1,3-diol. |
| Q: What is the CAS number of acetic acid,2-(chloromethoxy)propane-1,3-diol? |
| A: CAS number of acetic acid,2-(chloromethoxy)propane-1,3-diol is 86357-16-6. |
| Q: What is the InChIKey of acetic acid,2-(chloromethoxy)propane-1,3-diol? |
| A: InChIKey of acetic acid,2-(chloromethoxy)propane-1,3-diol is RWNVHBCBGFNXKJ-UHFFFAOYSA-N. |
| Q: What English synonyms does acetic acid,2-(chloromethoxy)propane-1,3-diol have? |
| A: English synonyms of acetic acid,2-(chloromethoxy)propane-1,3-diol: chloromethyl 1,3-diacetoxy-2-propyl ether, 1,3-Propanediol,2-(chloromethoxy)-,diacetate. |
| Q: What is the SMILES notation of acetic acid,2-(chloromethoxy)propane-1,3-diol? |
| A: SMILES notation of acetic acid,2-(chloromethoxy)propane-1,3-diol is CC(=O)O.CC(=O)O.OCC(CO)OCCl. |
| Q: What is the molecular weight of acetic acid,2-(chloromethoxy)propane-1,3-diol? |
| A: Molecular weight of acetic acid,2-(chloromethoxy)propane-1,3-diol is 260.66900. |
| Q: What is the Chinese name of 86357-16-6? |
| A: Chinese name of 86357-16-6 is 86357-16-6. |