ganciclovir diacetate
ganciclovir diacetate structure
|
Common Name | ganciclovir diacetate | ||
|---|---|---|---|---|
| CAS Number | 86357-19-9 | Molecular Weight | 339.30400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17N5O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ganciclovir diacetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17N5O6 |
|---|---|
| Molecular Weight | 339.30400 |
| Exact Mass | 339.11800 |
| PSA | 151.42000 |
| InChIKey | NSZKHEYZLNPIEJ-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(COC(C)=O)OCn1cnc2c(=O)[nH]c(N)nc21 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 4 | |
CAS#:82410-32-0
CAS#:64-19-7![2-[(2,6-diaminopurin-9-yl)methoxy]propane-1,3-diol structure](https://image.chemsrc.com/caspic/487/86629-59-6.png)
CAS#:86629-59-6![2-[(2-aminopurin-9-yl)methoxy]propane-1,3-diol structure](https://image.chemsrc.com/caspic/202/89419-23-8.png)
CAS#:89419-23-8This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Antiviral activity in vero cells against HSV-1 F strain; No data.
Source: ChEMBL
Target: Human alphaherpesvirus 1
External Id: CHEMBL815225
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of ganciclovir diacetate? |
| A: InChIKey of ganciclovir diacetate is NSZKHEYZLNPIEJ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 86357-19-9? |
| A: Chinese name of 86357-19-9 is 86357-19-9. |
| Q: What is the English name of ganciclovir diacetate? |
| A: The English name of ganciclovir diacetate is ganciclovir diacetate. |
| Q: What is the molecular formula of ganciclovir diacetate? |
| A: Molecular formula of ganciclovir diacetate is C13H17N5O6. |
| Q: What is the molecular weight of ganciclovir diacetate? |
| A: Molecular weight of ganciclovir diacetate is 339.30400. |
| Q: What is the SMILES notation of ganciclovir diacetate? |
| A: SMILES notation of ganciclovir diacetate is CC(=O)OCC(COC(C)=O)OCn1cnc2c(=O)[nH]c(N)nc21. |
| Q: What is the CAS number of ganciclovir diacetate? |
| A: CAS number of ganciclovir diacetate is 86357-19-9. |
| Q: What are the downstream products of ganciclovir diacetate? |
| A: Related downstream products(CAS) of ganciclovir diacetate: 82410-32-0;64-19-7;86629-59-6;89419-23-8. |
| Q: What is the polar surface area (PSA) of ganciclovir diacetate? |
| A: Polar surface area (PSA) of ganciclovir diacetate is 151.42000. |