(24E)-3β-Hydroxy-5α-lanosta-8,24-dien-26-oic acid structure
|
Common Name | (24E)-3β-Hydroxy-5α-lanosta-8,24-dien-26-oic acid | ||
|---|---|---|---|---|
| CAS Number | 86420-19-1 | Molecular Weight | 456.70 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 567.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C30H48O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 311.2±26.6 °C | |
Use of (24E)-3β-Hydroxy-5α-lanosta-8,24-dien-26-oic acidGanoderic acid Z is a ganoderic acid. Ganoderic acid Z, the lanostane triterpenoid, can be isolated from mushrooms of the genus Ganoderma[1]. |
| Name | (3β,24E)-3-Hydroxylanosta-8,24-dien-26-oic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Ganoderic acid Z is a ganoderic acid. Ganoderic acid Z, the lanostane triterpenoid, can be isolated from mushrooms of the genus Ganoderma[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 567.8±50.0 °C at 760 mmHg |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.70 |
| Flash Point | 311.2±26.6 °C |
| Exact Mass | 456.360352 |
| LogP | 9.44 |
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | KGELVXQPIUKGCO-SPPZYOJVSA-N |
| SMILES | CC(=CCCC(C)C1CCC2(C)C3=C(CCC12C)C1(C)CCC(O)C(C)(C)C1CC3)C(=O)O |
| Lanosta-8,24-dien-26-oic acid, 3-hydroxy-, (3β,24E)- |
| (3β,24E)-3-Hydroxylanosta-8,24-dien-26-oic acid |
| (3β,24E)-3-Hydroxylanosta-8,24-dien-26-oic acid |