JWH-302 structure
|
Common Name | JWH-302 | ||
|---|---|---|---|---|
| CAS Number | 864445-45-4 | Molecular Weight | 335.439 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 506.4±30.0 °C at 760 mmHg | |
| Molecular Formula | C22H25NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.1±24.6 °C | |
Use of JWH-302JWH 302 is a cannabimimetic indole that shows 5-fold selectivity for the central cannabinoid (CB1) receptor with a Ki value of 17 nM compared to the peripheral cannabinoid (CB2) receptor (Ki = 89 nM). |
| Name | 2-(3-methoxyphenyl)-1-(1-pentylindol-3-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 506.4±30.0 °C at 760 mmHg |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.439 |
| Flash Point | 260.1±24.6 °C |
| Exact Mass | 335.188538 |
| PSA | 31.23000 |
| LogP | 5.12 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | XZVYWLVYUAQEIM-UHFFFAOYSA-N |
| SMILES | CCCCCn1cc(C(=O)Cc2cccc(OC)c2)c2ccccc21 |
| 2-(3-Methoxyphenyl)-1-(1-pentyl-1H-indol-3-yl)ethanone |
| Ethanone, 2-(3-methoxyphenyl)-1-(1-pentyl-1H-indol-3-yl)- |
| JWH-302 |