6-bromo-5-(1,3-dioxan-2-yl)benzo[1,3]dioxole structure
|
Common Name | 6-bromo-5-(1,3-dioxan-2-yl)benzo[1,3]dioxole | ||
|---|---|---|---|---|
| CAS Number | 86449-40-3 | Molecular Weight | 287.10700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-bromo-6-(1,3-dioxan-2-yl)-1,3-benzodioxole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H11BrO4 |
|---|---|
| Molecular Weight | 287.10700 |
| Exact Mass | 285.98400 |
| PSA | 36.92000 |
| LogP | 2.61330 |
| InChIKey | IUZOCFKCVBEZNY-UHFFFAOYSA-N |
| SMILES | Brc1cc2c(cc1C1OCCCO1)OCO2 |
|
~91%
6-bromo-5-(1,3-... CAS#:86449-40-3 |
| Literature: Paulsen; Stubbe 1983 , vol. No. 4, p. 535 - 556 |
|
~%
6-bromo-5-(1,3-... CAS#:86449-40-3 |
| Literature: Meyers,A.I.; Flisak,J.R.; Aitken,R.A. Journal of the American Chemical Society, 1987 , vol. 109, p. 5446 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-<1-(2-bromo-4,5-methylenedioxyphenyl)>-1,3-dioxane |
| HMS3078C18 |
| 5-bromo-6-[1,3]dioxan-2-yl-benzo[1,3]dioxole |
| 5-bromo-6-(1,3-dioxan-2-yl)benzo[d][1,3]dioxole |
| 6-Brompiperonal-trimethylenacetal |
| 2-(6-Brom-3,4-methylendioxy-phenyl)-1,3-dioxan |