2-bromo-1-[6-(2-bromoacetyl)pyren-1-yl]ethanone structure
|
Common Name | 2-bromo-1-[6-(2-bromoacetyl)pyren-1-yl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 86471-05-8 | Molecular Weight | 444.11600 | |
| Density | 1.766g/cm3 | Boiling Point | 567.6ºC at 760 mmHg | |
| Molecular Formula | C20H12Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157ºC | |
| Name | 2-bromo-1-[6-(2-bromoacetyl)pyren-1-yl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.766g/cm3 |
|---|---|
| Boiling Point | 567.6ºC at 760 mmHg |
| Molecular Formula | C20H12Br2O2 |
| Molecular Weight | 444.11600 |
| Flash Point | 157ºC |
| Exact Mass | 441.92000 |
| PSA | 34.14000 |
| LogP | 5.73920 |
| Index of Refraction | 1.805 |
| InChIKey | NFGAUEODDIPMIJ-UHFFFAOYSA-N |
| SMILES | O=C(CBr)c1ccc2ccc3c(C(=O)CBr)ccc4ccc1c2c43 |
|
~41%
2-bromo-1-[6-(2... CAS#:86471-05-8 |
| Literature: Harvey, Ronald G.; Konieczny, Maria; Pataki, John Journal of Organic Chemistry, 1983 , vol. 48, # 17 p. 2930 - 2932 |
| 1,6-bis(bromoacetyl)pyrene |
| 1,1'-pyrene-1,6-diylbis(2-bromoethanone) |