2-Naphthalenecarboxylic acid, 6-bromo-, ethyl ester structure
|
Common Name | 2-Naphthalenecarboxylic acid, 6-bromo-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 86471-14-9 | Molecular Weight | 279.12900 | |
| Density | 1.437±0.06 g/cm3(Predicted) | Boiling Point | 369.3±15.0 °C(Predicted) | |
| Molecular Formula | C13H11BrO2 | Melting Point | 67-68 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 6-bromonaphthalene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.437±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 369.3±15.0 °C(Predicted) |
| Melting Point | 67-68 °C |
| Molecular Formula | C13H11BrO2 |
| Molecular Weight | 279.12900 |
| Exact Mass | 277.99400 |
| PSA | 26.30000 |
| LogP | 3.77900 |
| InChIKey | FJNDHRWJMFOBCX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc2cc(Br)ccc2c1 |
| Storage condition | 2-8°C |
|
~94%
2-Naphthaleneca... CAS#:86471-14-9 |
| Literature: Pfahl, Magnus; Tachdjian, Catherine; Al-Shamma, Hussien A.; Fanjul, Andrea; Pleynet, David P.M.; Spruce, Lyle W.; Wiemann, Torsten R.; Ibarra, Jason B. Patent: US2002/143182 A1, 2002 ; |
|
~%
2-Naphthaleneca... CAS#:86471-14-9 |
| Literature: Allergan Sales, Inc. Patent: US5877207 A1, 1999 ; Title/Abstract Full Text Show Details Allergan Sales, Inc. Patent: US5958954 A1, 1999 ; US 5958954 A |
|
~%
2-Naphthaleneca... CAS#:86471-14-9 |
| Literature: Anderson; Johnston Journal of the American Chemical Society, 1943 , vol. 65, p. 239,241 |
| 6-Brom-[2]naphthoesaeure-aethylester |
| Ethyl 2-bromo-6-naphthalenecarboxylate |
| ethyl 6-bromo-2-naphthalenecarboxylate |
| ethyl 6-bromo-2-naphthoate |
| 6-bromo-[2]naphthoic acid ethyl ester |
| ethyl 6-bromo-naphthalene-2-carboxylate |