Decamethyltetrasilane structure
|
Common Name | Decamethyltetrasilane | ||
|---|---|---|---|---|
| CAS Number | 865-76-9 | Molecular Weight | 262.68700 | |
| Density | 0.78g/cm3 | Boiling Point | 219.6ºC at 760 mmHg | |
| Molecular Formula | C10H30Si4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 61.6ºC | |
| Name | [dimethyl(trimethylsilyl)silyl]-dimethyl-trimethylsilylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.78g/cm3 |
|---|---|
| Boiling Point | 219.6ºC at 760 mmHg |
| Molecular Formula | C10H30Si4 |
| Molecular Weight | 262.68700 |
| Flash Point | 61.6ºC |
| Exact Mass | 262.14200 |
| LogP | 4.31480 |
| Index of Refraction | 1.409 |
| InChIKey | WYNNMDYMPQMXFH-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)[Si](C)(C)[Si](C)(C)[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Tetrasilane,decamethyl |
| Decamethyl-tetrasilan |
| Decamethyltetrasilane |