6-(Dipropylamino)-5-hydroxy-4-oxo-4H-pyran-2-carboxylic acid
Modify Date: 2025-09-28 17:22:11
6-(Dipropylamino)-5-hydroxy-4-oxo-4H-pyran-2-carboxylic acid structure
|
Common Name | 6-(Dipropylamino)-5-hydroxy-4-oxo-4H-pyran-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 86525-19-1 | Molecular Weight | 255.26700 | |
| Density | 1.3g/cm3 | Boiling Point | 410.8ºC at 760 mmHg | |
| Molecular Formula | C12H17NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.2ºC | |
| Name | 6-(dipropylamino)-5-hydroxy-4-oxopyran-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 410.8ºC at 760 mmHg |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.26700 |
| Flash Point | 202.2ºC |
| Exact Mass | 255.11100 |
| PSA | 90.98000 |
| LogP | 1.67000 |
| Index of Refraction | 1.561 |
| InChIKey | PGQDYJKCRCCPMW-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)c1oc(C(=O)O)cc(=O)c1O |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-(Dipropylamino)-5-hydroxy-4-oxo-4H-pyran-2-carboxylic acid |
| 6-Dipropylaminocomenic acid |
| 4H-Pyran-2-carboxylic acid,6-(dipropylamino)-5-hydroxy-4-oxo |