β-Apo-13-carotenone D3 structure
|
Common Name | β-Apo-13-carotenone D3 | ||
|---|---|---|---|---|
| CAS Number | 86530-28-1 | Molecular Weight | 261.42 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H23D3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of β-Apo-13-carotenone D3β-Apo-13-carotenone D3 is the deuterium labeled β-Apo-13-carotenone. β-Apo-13-carotenone (D'Orenone) is a naturally occurring β-apocarotenoid functioned as an antagonist of RXRα. |
| Name | β-Apo-13-carotenone D3 |
|---|
| Description | β-Apo-13-carotenone D3 is the deuterium labeled β-Apo-13-carotenone. β-Apo-13-carotenone (D'Orenone) is a naturally occurring β-apocarotenoid functioned as an antagonist of RXRα. |
|---|---|
| Related Catalog |
| Molecular Formula | C18H23D3O |
|---|---|
| Molecular Weight | 261.42 |
| InChIKey | UBTNVRPIHJRBCI-UUTGIGQUSA-N |
| SMILES | CC(=O)C=CC=C(C)C=CC1=C(C)CCCC1(C)C |
| Storage condition | 2-8℃ |