TCMDC-132471 structure
|
Common Name | TCMDC-132471 | ||
|---|---|---|---|---|
| CAS Number | 865304-71-8 | Molecular Weight | 274.318 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 455.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C14H18N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.2±31.5 °C | |
| Name | 5-(4-methoxy-2-propan-2-ylphenoxy)pyrimidine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 455.4±55.0 °C at 760 mmHg |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.318 |
| Flash Point | 229.2±31.5 °C |
| Exact Mass | 274.142975 |
| PSA | 97.74000 |
| LogP | 2.18 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | HIKYTWIVLKHYIM-UHFFFAOYSA-N |
| SMILES | COc1ccc(Oc2cnc(N)nc2N)c(C(C)C)c1 |
|
~%
TCMDC-132471 CAS#:865304-71-8 |
| Literature: Roche Palo Alto LLC Patent: US2008/86004 A1, 2008 ; Location in patent: Page/Page column 15 ; |
|
~%
TCMDC-132471 CAS#:865304-71-8 |
| Literature: Carter, David S.; Alam, Muzaffar; Cai, Haiying; Dillon, Michael P.; Ford, Anthony P.D.W.; Gever, Joel R.; Jahangir, Alam; Lin, Clara; Moore, Amy G.; Wagner, Paul J.; Zhai, Yansheng Bioorganic and Medicinal Chemistry Letters, 2009 , vol. 19, # 6 p. 1628 - 1631 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 2,4-Pyrimidinediamine, 5-[4-methoxy-2-(1-methylethyl)phenoxy]- |
| 5-(2-Isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine |
| TCMDC-132471 |
| 5-(4-methoxy-2-propan-2-yl-phenoxy)pyrimidine-2,4-diamine |
| 5-(2-Isopropyl-4-methoxyphenoxy)pyrimidine-2,4-diamine |