10-tert-butylperoxy-10-methylanthracen-9-one structure
|
Common Name | 10-tert-butylperoxy-10-methylanthracen-9-one | ||
|---|---|---|---|---|
| CAS Number | 86543-49-9 | Molecular Weight | 296.36000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 10-tert-butylperoxy-10-methylanthracen-9-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H20O3 |
|---|---|
| Molecular Weight | 296.36000 |
| Exact Mass | 296.14100 |
| PSA | 35.53000 |
| LogP | 4.24120 |
| InChIKey | PIUASEUYGQACJB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OOC1(C)c2ccccc2C(=O)c2ccccc21 |
|
~3%
10-tert-butylpe... CAS#:86543-49-9 |
| Literature: Ito,Y.; Matsuura,A.; Otani,R. Journal of the American Chemical Society, 1983 , vol. 105, p. 5699 |
|
~74%
10-tert-butylpe... CAS#:86543-49-9 |
| Literature: Ito,Y.; Matsuura,A.; Otani,R. Journal of the American Chemical Society, 1983 , vol. 105, p. 5699 |
|
~19%
10-tert-butylpe... CAS#:86543-49-9 |
| Literature: Ito, Yoshikatsu; Matsuura, Akira; Matsuura, Teruo Tetrahedron Letters, 1984 , vol. 25, # 14 p. 1491 - 1494 |
|
~7%
Detail
|
| Literature: Matsuura, Akira; Nishinaga, Akira; Ito, Yoshikatsu; Matsuura, Teruo Chemistry Letters, 1985 , p. 993 - 996 |
| 10-methyl-10-(tert-butylsioxy)-9-anthrone |
| 9(10H)-Anthracenone,10-[(1,1-dimethylethyl)dioxy]-10-methyl |
| 10-methyl-10-tert-butylperoxy-9-anthrone |
| 10-t-butyldioxy-10-methyl-9-anthrone |
| 10-methyl-10-(tert-butyldioxy)-9-anthrone |