4-[(4-Aminophenyl)sulfonyl]-N,N-dimethylbenzenamine structure
|
Common Name | 4-[(4-Aminophenyl)sulfonyl]-N,N-dimethylbenzenamine | ||
|---|---|---|---|---|
| CAS Number | 86552-09-2 | Molecular Weight | 276.35400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[4-(dimethylamino)phenyl]sulfonylaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16N2O2S |
|---|---|
| Molecular Weight | 276.35400 |
| Exact Mass | 276.09300 |
| PSA | 71.78000 |
| LogP | 3.82960 |
| InChIKey | BAFBTALEMBECSK-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(S(=O)(=O)c2ccc(N)cc2)cc1 |
| HS Code | 2921590090 |
|---|
|
~%
4-[(4-Aminophen... CAS#:86552-09-2 |
| Literature: Knuesli Gazzetta Chimica Italiana, 1950 , vol. 80, p. 522,524 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Inhibitory activity against dihydropteroic acid synthase (SYN) from Mycobacterium luf...
Source: ChEMBL
Target: N/A
External Id: CHEMBL660536
|
|
Name: In vitro inhibition of Mycobacterium lufu dihydopterate synthase.
Source: ChEMBL
Target: N/A
External Id: CHEMBL664455
|
|
Name: Inhibition of dihydropteroate synthase of Escherichia coli
Source: ChEMBL
Target: Dihydropteroate synthase
External Id: CHEMBL664441
|
|
Name: Inhibitory activity against dihydropteroic acid synthase (SYN) from Escherichia coli;...
Source: ChEMBL
Target: N/A
External Id: CHEMBL664462
|
|
Name: Inhibitory activity against dihydropteroic acid synthase (SYN) from Mycobacterium luf...
Source: ChEMBL
Target: N/A
External Id: CHEMBL664463
|
| 4-(4-dimethylaminophenyl)sulfonylaniline |
| N,N-Dimethyl-4,4'-sulfonyl-di-anilin |
| Benzenamine,4-[(4-aminophenyl)sulfonyl]-N,N-dimethyl |
| (4-amino-phenyl)-(4-dimethylamino-phenyl)-sulfone |