methyl 2-diphenylphosphorylpropanoate structure
|
Common Name | methyl 2-diphenylphosphorylpropanoate | ||
|---|---|---|---|---|
| CAS Number | 86581-80-8 | Molecular Weight | 288.27800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-diphenylphosphorylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H17O3P |
|---|---|
| Molecular Weight | 288.27800 |
| Exact Mass | 288.09200 |
| PSA | 53.18000 |
| LogP | 2.56200 |
| InChIKey | UXAFGTVPTMLTGT-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C)P(=O)(c1ccccc1)c1ccccc1 |
|
~0%
methyl 2-diphen... CAS#:86581-80-8 |
| Literature: Levin, Daniel; Warren, Stuart Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1988 , p. 1799 - 1808 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| Methyl 2-diphenylphosphinoylpropanoate |
| diphenyl phosphinoxy-2-propionate de methyle |
| Propanoic acid,2-(diphenylphosphinyl)-,methyl ester |