Heptane, 7-(bis((2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl)oxy)methoxy)-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro- structure
|
Common Name | Heptane, 7-(bis((2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl)oxy)methoxy)-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro- | ||
|---|---|---|---|---|
| CAS Number | 866-03-5 | Molecular Weight | 1006.26000 | |
| Density | 1.651g/cm3 | Boiling Point | 411.4ºC at 760 mmHg | |
| Molecular Formula | C22H10F36O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.5ºC | |
| Name | 7-[bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)methoxy]-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoroheptane |
|---|
| Density | 1.651g/cm3 |
|---|---|
| Boiling Point | 411.4ºC at 760 mmHg |
| Molecular Formula | C22H10F36O3 |
| Molecular Weight | 1006.26000 |
| Flash Point | 211.5ºC |
| Exact Mass | 1006.01000 |
| PSA | 27.69000 |
| LogP | 11.64460 |
| Index of Refraction | 1.301 |
| InChIKey | LBKLNJVDFAZVHX-UHFFFAOYSA-N |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)COC(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
|
~%
Heptane, 7-(bis... CAS#:866-03-5 |
| Literature: Hill,M.E. et al. Journal of Organic Chemistry, 1965 , vol. 30, p. 411 - 415 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |