trichloro(3,3,4,4,5,5,5-heptafluoropentyl)silane structure
|
Common Name | trichloro(3,3,4,4,5,5,5-heptafluoropentyl)silane | ||
|---|---|---|---|---|
| CAS Number | 866-24-0 | Molecular Weight | 331.51900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H4Cl3F7Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trichloro(3,3,4,4,5,5,5-heptafluoropentyl)silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C5H4Cl3F7Si |
|---|---|
| Molecular Weight | 331.51900 |
| Exact Mass | 329.90400 |
| LogP | 4.86470 |
| InChIKey | HPQDRJIVNDILHK-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)CC[Si](Cl)(Cl)Cl |
|
~%
trichloro(3,3,4... CAS#:866-24-0 |
| Literature: El-Abbady; Anderson Journal of the American Chemical Society, 1958 , vol. 80, p. 1737 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| trichloro-(3,3,4,4,5,5,5-heptafluoro-pentyl)-silane |
| Trichlor-(3,3,4,4,5,5,5-heptafluor-pentyl)-silan |
| Silane,trichloro(3,3,4,4,5,5,5-heptafluoropentyl) |