2,3,5-Trimethyl-4-nitropyridine 1-oxide
Modify Date: 2025-08-28 10:09:23
2,3,5-Trimethyl-4-nitropyridine 1-oxide structure
|
Common Name | 2,3,5-Trimethyl-4-nitropyridine 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 86604-79-7 | Molecular Weight | 182.177 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 397.8±37.0 °C at 760 mmHg | |
| Molecular Formula | C8H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.4±26.5 °C | |
| Name | 2,3,5-trimethyl-4-nitro-1-oxidopyridin-1-ium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 397.8±37.0 °C at 760 mmHg |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.177 |
| Flash Point | 194.4±26.5 °C |
| Exact Mass | 182.069138 |
| PSA | 71.28000 |
| LogP | 0.83 |
| Appearance of Characters | NA |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | YMBLTOGTYNFTRX-UHFFFAOYSA-N |
| SMILES | Cc1c[n+]([O-])c(C)c(C)c1[N+](=O)[O-] |
| HS Code | 2933399090 |
|---|
|
~97%
2,3,5-Trimethyl... CAS#:86604-79-7 |
| Literature: CONFORMA THERAPEUTICS CORPORATION Patent: WO2005/28434 A2, 2005 ; Location in patent: Page/Page column 332 ; |
|
~%
2,3,5-Trimethyl... CAS#:86604-79-7 |
| Literature: US4555518 A1, ; |
|
~%
2,3,5-Trimethyl... CAS#:86604-79-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 35, # 6 p. 1049 - 1057 |
|
~%
2,3,5-Trimethyl... CAS#:86604-79-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 50, # 12 p. 2767 - 2778 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
CAS#:109371-18-8
CAS#:86604-75-3
CAS#:86604-78-6
CAS#:103014-07-9
CAS#:109371-20-2![2-[(3,5-dimethyl-4-nitropyridin-2-yl)methylsulfanyl]-6-methoxy-1H-benzimidazole structure](https://image.chemsrc.com/caspic/130/142885-91-4.png)
CAS#:142885-91-4
CAS#:149082-03-1![2-[(4-methoxy-3,5-dimethylpyridin-2-yl)methylsulfanyl]-1H-benzimidazole structure](https://image.chemsrc.com/caspic/012/73590-87-1.png)
CAS#:73590-87-1
CAS#:86604-80-0
CAS#:91219-90-8| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3,5-Trimethyl-4-nitropyridine 1-oxide |
| T6NJ AO B1 C1 DNW E1 |
| N-oxide of 2,3,5-trimethyl-4-nitropyridine |
| 2,3,5-Trimethyl-4-nitropyridine N-oxide |
| Pyridine, 2,3,5-trimethyl-4-nitro-, 1-oxide |
| 4-nitro-2,3,5-trimethyl pyridine-N-oxide |
| 4-nitro-2,3,5-trimethylpyridine 1-oxide |
| 2,3,5-trimethyl-4-nitropyridine-N-oxide |
| Esomeprazole Impurity 21 |