3-BIPHENYL-3',4'-DIFLUORO-ACETICACID structure
|
Common Name | 3-BIPHENYL-3',4'-DIFLUORO-ACETICACID | ||
|---|---|---|---|---|
| CAS Number | 866108-76-1 | Molecular Weight | 248.22500 | |
| Density | 1.302g/cm3 | Boiling Point | 384.6ºC at 760 mmHg | |
| Molecular Formula | C14H10F2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.4ºC | |
| Name | 2-[3-(3,4-difluorophenyl)phenyl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.302g/cm3 |
|---|---|
| Boiling Point | 384.6ºC at 760 mmHg |
| Molecular Formula | C14H10F2O2 |
| Molecular Weight | 248.22500 |
| Flash Point | 186.4ºC |
| Exact Mass | 248.06500 |
| PSA | 37.30000 |
| LogP | 3.25890 |
| Index of Refraction | 1.563 |
| InChIKey | LNCISQVUJFQGMA-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1cccc(-c2ccc(F)c(F)c2)c1 |
| HS Code | 2916399090 |
|---|
|
~%
3-BIPHENYL-3',4... CAS#:866108-76-1 |
| Literature: Kotsikorou, Evangelia; Song, Yongcheng; Chan, Julian M. W.; Faelens, Stephanie; Tovian, Zev; Broderick, Erin; Bakalara, Norbert; Docampo, Roberta; Oldfield, Eric Journal of Medicinal Chemistry, 2005 , vol. 48, # 19 p. 6128 - 6139 |
|
~%
3-BIPHENYL-3',4... CAS#:866108-76-1 |
| Literature: Kotsikorou, Evangelia; Song, Yongcheng; Chan, Julian M. W.; Faelens, Stephanie; Tovian, Zev; Broderick, Erin; Bakalara, Norbert; Docampo, Roberta; Oldfield, Eric Journal of Medicinal Chemistry, 2005 , vol. 48, # 19 p. 6128 - 6139 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| (3',4'-difluoro-biphenyl-3-yl)-acetic acid |
| 3-biphenyl-3',4'-difluoro-acetic acid |
| 3',4'-difluoro-biphenyl-3-acetic acid |
| 3-(3,4-difluorophenyl)phenylacetic acid |