4,6-dichloro-2-octylsulfanylpyrimidine structure
|
Common Name | 4,6-dichloro-2-octylsulfanylpyrimidine | ||
|---|---|---|---|---|
| CAS Number | 86627-14-7 | Molecular Weight | 293.25600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18Cl2N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,6-dichloro-2-octylsulfanylpyrimidine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H18Cl2N2S |
|---|---|
| Molecular Weight | 293.25600 |
| Exact Mass | 292.05700 |
| PSA | 51.08000 |
| LogP | 5.23600 |
| InChIKey | UGJZFWLNPIRHPT-UHFFFAOYSA-N |
| SMILES | CCCCCCCCSc1nc(Cl)cc(Cl)n1 |
|
~65%
4,6-dichloro-2-... CAS#:86627-14-7 |
| Literature: d'Atri; Gomarasca; Resnati; Tronconi; Scolastico; Sirtori Journal of Medicinal Chemistry, 1984 , vol. 27, # 12 p. 1621 - 1629 |
|
~%
4,6-dichloro-2-... CAS#:86627-14-7 |
| Literature: d'Atri; Gomarasca; Resnati; Tronconi; Scolastico; Sirtori Journal of Medicinal Chemistry, 1984 , vol. 27, # 12 p. 1621 - 1629 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 4,6-dichloro-2-(octylthio)pyrimidine |
| 2-octylthio-4,6-dichloropyrimidine |
| Pyrimidine,4,6-dichloro-2-(octylthio) |