methyl 2-(4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-2-yl)acetate structure
|
Common Name | methyl 2-(4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-2-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 86628-26-4 | Molecular Weight | 251.30200 | |
| Density | 1.234g/cm3 | Boiling Point | 421.5ºC at 760 mmHg | |
| Molecular Formula | C12H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.7ºC | |
| Name | methyl 2-(4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-2-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.234g/cm3 |
|---|---|
| Boiling Point | 421.5ºC at 760 mmHg |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.30200 |
| Flash Point | 208.7ºC |
| Exact Mass | 251.06200 |
| PSA | 84.19000 |
| LogP | 2.13770 |
| Index of Refraction | 1.559 |
| InChIKey | CWFCFMFPXZUQKT-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1CC(=O)Nc2ccccc2S1 |
|
~%
methyl 2-(4-oxo... CAS#:86628-26-4 |
| Literature: Shridhar, D. R.; Sastry, C. V. Reddy; Lal, B. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1983 , vol. 22, # 3 p. 300 - 302 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Methyl 2,3,4,5-tetrahydro-5-oxo-1,4-benzothiazepine-2-acetate |
| 1,5-Benzothiazepine-2-acetic acid,2,3,4,5-tetrahydro-4-oxo-,methyl ester |
| Methyl 2,3-dihydro-1,5-benzothiazepin-5(4H)-one-2-acetate |