Cyclohexanol,2-(dimethylamino)-1-(1-phenylethenyl)-, cis- (9CI) structure
|
Common Name | Cyclohexanol,2-(dimethylamino)-1-(1-phenylethenyl)-, cis- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 86632-95-3 | Molecular Weight | 245.36000 | |
| Density | 1.04g/cm3 | Boiling Point | 364.4ºC at 760mmHg | |
| Molecular Formula | C16H23NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.4ºC | |
| Name | 2-(dimethylamino)-1-(1-phenylethenyl)cyclohexan-1-ol |
|---|
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 364.4ºC at 760mmHg |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.36000 |
| Flash Point | 163.4ºC |
| Exact Mass | 245.17800 |
| PSA | 23.47000 |
| LogP | 2.93510 |
| Index of Refraction | 1.558 |
| InChIKey | MLNPNKQUANSWIW-UHFFFAOYSA-N |
| SMILES | C=C(c1ccccc1)C1(O)CCCCC1N(C)C |
|
~%
Cyclohexanol,2-... CAS#:86632-95-3 |
| Literature: Overman, Larry E.; Jacobsen E. Jon; Doedens, Robert J. Journal of Organic Chemistry, 1983 , vol. 48, # 20 p. 3393 - 3400 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |