3-(2-(1,3-DIOXOLAN-2-YL)ETHYL)-7,8-DIMETHOXY-4,5-DIHYDRO-1H-BENZO[D]AZEPIN-2(3H)-ONE structure
|
Common Name | 3-(2-(1,3-DIOXOLAN-2-YL)ETHYL)-7,8-DIMETHOXY-4,5-DIHYDRO-1H-BENZO[D]AZEPIN-2(3H)-ONE | ||
|---|---|---|---|---|
| CAS Number | 866462-51-3 | Molecular Weight | 321.368 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 506.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C17H23NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.8±30.1 °C | |
| Name | 3-[2-(1,3-dioxolan-2-yl)ethyl]-7,8-dimethoxy-2,5-dihydro-1H-3-benzazepin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 506.0±50.0 °C at 760 mmHg |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.368 |
| Flash Point | 259.8±30.1 °C |
| Exact Mass | 321.157623 |
| PSA | 57.23000 |
| LogP | 0.96 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | WBLSXQWVJABURL-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OC)CC(=O)N(CCC1OCCO1)CC2 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-[2-(1,3-Dioxolan-2-yl)ethyl]-7,8-dimethoxy-1,3,4,5-tetrahydro-2H-3-benzazepin-2-one |
| 2H-3-Benzazepin-2-one, 3-[2-(1,3-dioxolan-2-yl)ethyl]-1,3,4,5-tetrahydro-7,8-dimethoxy- |