1-(3-chloro-4-methylphenyl)-3-methyl-1H-pyrazol-5-amine structure
|
Common Name | 1-(3-chloro-4-methylphenyl)-3-methyl-1H-pyrazol-5-amine | ||
|---|---|---|---|---|
| CAS Number | 866472-29-9 | Molecular Weight | 221.68600 | |
| Density | 1.28g/cm3 | Boiling Point | 379ºC at 760 mmHg | |
| Molecular Formula | C11H12ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183ºC | |
| Name | 2-(3-chloro-4-methylphenyl)-5-methylpyrazol-3-amine |
|---|
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 379ºC at 760 mmHg |
| Molecular Formula | C11H12ClN3 |
| Molecular Weight | 221.68600 |
| Flash Point | 183ºC |
| Exact Mass | 221.07200 |
| PSA | 43.84000 |
| LogP | 3.30590 |
| Index of Refraction | 1.628 |
| InChIKey | RQSIXJBWUWRVKB-UHFFFAOYSA-N |
| SMILES | Cc1cc(N)n(-c2ccc(C)c(Cl)c2)n1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |