N-(4-fluorophenethyl)-5-(2-(methylamino)pyrimidin-4-yl)thiophene-2-carboxamide structure
|
Common Name | N-(4-fluorophenethyl)-5-(2-(methylamino)pyrimidin-4-yl)thiophene-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 866519-97-3 | Molecular Weight | 356.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H17FN4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-fluorophenethyl)-5-(2-(methylamino)pyrimidin-4-yl)thiophene-2-carboxamide |
|---|
| Molecular Formula | C18H17FN4OS |
|---|---|
| Molecular Weight | 356.4 |
| InChIKey | VQWCRDHPNXZMIT-UHFFFAOYSA-N |
| SMILES | CNc1nccc(-c2ccc(C(=O)NCCc3ccc(F)cc3)s2)n1 |
|
Name: Inhibition of AKT3 in presence of 0.2 uM ATP
Source: ChEMBL
Target: RAC-gamma serine/threonine-protein kinase
External Id: CHEMBL868042
|