methyl (E)-3-(1-acetylpyrazol-4-yl)prop-2-enoate structure
|
Common Name | methyl (E)-3-(1-acetylpyrazol-4-yl)prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 866621-25-2 | Molecular Weight | 194.18700 | |
| Density | 1.18g/cm3 | Boiling Point | 344.9ºC at 760 mmHg | |
| Molecular Formula | C9H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.4ºC | |
| Name | methyl (E)-3-(1-acetylpyrazol-4-yl)prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 344.9ºC at 760 mmHg |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.18700 |
| Flash Point | 162.4ºC |
| Exact Mass | 194.06900 |
| PSA | 61.19000 |
| LogP | 0.72940 |
| Index of Refraction | 1.537 |
| InChIKey | YMJTVSONSPGBKF-ONEGZZNKSA-N |
| SMILES | COC(=O)C=Cc1cnn(C(C)=O)c1 |
|
~99%
methyl (E)-3-(1... CAS#:866621-25-2 |
| Literature: Kwok, Thomas J.; Virgilio, Joseph A. Organic Process Research and Development, 2005 , vol. 9, # 5 p. 694 - 696 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-(1-Acetyl-1H-pyrazol-4-yl)-acrylic acid methyl ester |
| (E)-methyl 3-(1-acetyl-1H-pyrazol-4-yl)acrylate |
| TPC-H002 |