Iodonium, bis[(1,1-dimethylethyl)phenyl]-, salt with perfluorohexanesulfonic acid (1:1) structure
|
Common Name | Iodonium, bis[(1,1-dimethylethyl)phenyl]-, salt with perfluorohexanesulfonic acid (1:1) | ||
|---|---|---|---|---|
| CAS Number | 866621-50-3 | Molecular Weight | 792.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H26F13IO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Iodonium, bis[(1,1-dimethylethyl)phenyl]-, salt with perfluorohexanesulfonic acid (1:1) |
|---|
| Molecular Formula | C26H26F13IO3S |
|---|---|
| Molecular Weight | 792.4 |
| InChIKey | JGBDZZPDMXIDQM-UHFFFAOYSA-M |
| SMILES | CC(C)(C)c1ccccc1[I+]c1ccccc1C(C)(C)C.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |