1-(2,5-dimethylbenzyl)-6,7-dimethoxy-3-(phenylsulfonyl)quinolin-4(1H)-one
Modify Date: 2026-06-21 18:39:26
1-(2,5-dimethylbenzyl)-6,7-dimethoxy-3-(phenylsulfonyl)quinolin-4(1H)-one structure
|
Common Name | 1-(2,5-dimethylbenzyl)-6,7-dimethoxy-3-(phenylsulfonyl)quinolin-4(1H)-one | ||
|---|---|---|---|---|
| CAS Number | 866726-32-1 | Molecular Weight | 463.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H25NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2,5-dimethylbenzyl)-6,7-dimethoxy-3-(phenylsulfonyl)quinolin-4(1H)-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C26H25NO5S |
|---|---|
| Molecular Weight | 463.5 |
| InChIKey | ODPJUEZWMKCTRF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)CN2C=C(C(=O)C3=CC(=C(C=C32)OC)OC)S(=O)(=O)C4=CC=CC=C4 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Identification of CBX7 inhibitors - Primary Alpha Screen
Source: 15290
Target: N/A
External Id: CBX7-Alpha-primary
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 866726-32-1? |
| A: Chinese name of 866726-32-1 is 866726-32-1. |
| Q: What is the SMILES notation of 1-(2,5-dimethylbenzyl)-6,7-dimethoxy-3-(phenylsulfonyl)quinolin-4(1H)-one? |
| A: SMILES notation of 1-(2,5-dimethylbenzyl)-6,7-dimethoxy-3-(phenylsulfonyl)quinolin-4(1H)-one is CC1=CC(=C(C=C1)C)CN2C=C(C(=O)C3=CC(=C(C=C32)OC)OC)S(=O)(=O)C4=CC=CC=C4. |
| Q: What is the English name of 1-(2,5-dimethylbenzyl)-6,7-dimethoxy-3-(phenylsulfonyl)quinolin-4(1H)-one? |
| A: The English name of 1-(2,5-dimethylbenzyl)-6,7-dimethoxy-3-(phenylsulfonyl)quinolin-4(1H)-one is 1-(2,5-dimethylbenzyl)-6,7-dimethoxy-3-(phenylsulfonyl)quinolin-4(1H)-one. |
| Q: What is the CAS number of 1-(2,5-dimethylbenzyl)-6,7-dimethoxy-3-(phenylsulfonyl)quinolin-4(1H)-one? |
| A: CAS number of 1-(2,5-dimethylbenzyl)-6,7-dimethoxy-3-(phenylsulfonyl)quinolin-4(1H)-one is 866726-32-1. |
| Q: What is the molecular weight of 1-(2,5-dimethylbenzyl)-6,7-dimethoxy-3-(phenylsulfonyl)quinolin-4(1H)-one? |
| A: Molecular weight of 1-(2,5-dimethylbenzyl)-6,7-dimethoxy-3-(phenylsulfonyl)quinolin-4(1H)-one is 463.5. |
| Q: What is the molecular formula of 1-(2,5-dimethylbenzyl)-6,7-dimethoxy-3-(phenylsulfonyl)quinolin-4(1H)-one? |
| A: Molecular formula of 1-(2,5-dimethylbenzyl)-6,7-dimethoxy-3-(phenylsulfonyl)quinolin-4(1H)-one is C26H25NO5S. |
| Q: What is the InChIKey of 1-(2,5-dimethylbenzyl)-6,7-dimethoxy-3-(phenylsulfonyl)quinolin-4(1H)-one? |
| A: InChIKey of 1-(2,5-dimethylbenzyl)-6,7-dimethoxy-3-(phenylsulfonyl)quinolin-4(1H)-one is ODPJUEZWMKCTRF-UHFFFAOYSA-N. |