(1S)-4,5-Dimethoxy-1-[(methylamino)methyl]benzocyclobutane hydrochloride structure
|
Common Name | (1S)-4,5-Dimethoxy-1-[(methylamino)methyl]benzocyclobutane hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 866783-13-3 | Molecular Weight | 243.730 | |
| Density | N/A | Boiling Point | 338.6ºC at 760 mmHg | |
| Molecular Formula | C12H18ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.6ºC | |
| Name | (1S)-4,5-Dimethoxy-1-[(methylamino)methyl]benzocyclobutane hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 338.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.730 |
| Flash Point | 158.6ºC |
| Exact Mass | 243.102600 |
| PSA | 30.49000 |
| LogP | 2.75580 |
| InChIKey | SWSAIQSQSDOONK-SBSPUUFOSA-N |
| SMILES | CNCC1Cc2cc(OC)c(OC)cc21.Cl |
| HS Code | 2942000000 |
|---|
|
~90%
(1S)-4,5-Dimeth... CAS#:866783-13-3 |
| Literature: Lerestif, Jean-Michel; Blanco, Isaac Gonzalez; Lecouve, Jean-Pierre; Brigot, Daniel Patent: US2005/261376 A1, 2005 ; Location in patent: Page/Page column 3 ; |
|
~88%
(1S)-4,5-Dimeth... CAS#:866783-13-3 |
| Literature: RICHTER GEDEON NYRT.; UJVARI, Viktor; BODI, Jozsef; FARAGO, Janos; SZKE, Katalin; FAIGL, Ferenc; NEMET, Zoltan; TEMESVARI, Krisztina; KISS, Robert; MATRAVOeLGYI, Bela; KASSAI, Ferencne; KISS-BARTOS, Dorottya Patent: WO2011/138625 A1, 2011 ; Location in patent: Page/Page column 42 ; |
|
~%
(1S)-4,5-Dimeth... CAS#:866783-13-3 |
| Literature: WO2011/138625 A1, ; |
|
~%
(1S)-4,5-Dimeth... CAS#:866783-13-3 |
| Literature: WO2011/138625 A1, ; |
|
~%
(1S)-4,5-Dimeth... CAS#:866783-13-3 |
| Literature: WO2011/138625 A1, ; |
|
~%
(1S)-4,5-Dimeth... CAS#:866783-13-3 |
| Literature: WO2011/138625 A1, ; |
|
~%
(1S)-4,5-Dimeth... CAS#:866783-13-3 |
| Literature: WO2011/138625 A1, ; |
|
~%
(1S)-4,5-Dimeth... CAS#:866783-13-3 |
| Literature: WO2011/138625 A1, ; |
|
~%
(1S)-4,5-Dimeth... CAS#:866783-13-3 |
| Literature: WO2011/138625 A1, ; |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-[(7S)-3,4-Dimethoxybicyclo[4.2.0]octa-1,3,5-trien-7-yl]-N-methylmethanamine hydrochloride (1:1) |
| Bicyclo[4.2.0]octa-1,3,5-triene-7-methanamine, 3,4-dimethoxy-N-methyl-, (7S)-, hydrochloride (1:1) |
| (1S)-4,5-Dimethoxy-1-[(methylamino)methyl]benzocyclobutane hydrochloride |
| 1-[(7S)-3,4-dimethoxy-7-bicyclo[4.2.0]octa-1,3,5-trienyl]-N-methylmethanamine,hydrochloride |