4-Morpholinepropanamine, alpha-methyl-N-(3-phenyl-5-isoxazolyl)- structure
|
Common Name | 4-Morpholinepropanamine, alpha-methyl-N-(3-phenyl-5-isoxazolyl)- | ||
|---|---|---|---|---|
| CAS Number | 86684-30-2 | Molecular Weight | 301.38300 | |
| Density | 1.138g/cm3 | Boiling Point | 513ºC at 760 mmHg | |
| Molecular Formula | C17H23N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.1ºC | |
| Name | N-(4-morpholin-4-ylbutan-2-yl)-3-phenyl-1,2-oxazol-5-amine |
|---|
| Density | 1.138g/cm3 |
|---|---|
| Boiling Point | 513ºC at 760 mmHg |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.38300 |
| Flash Point | 264.1ºC |
| Exact Mass | 301.17900 |
| PSA | 50.53000 |
| LogP | 2.87520 |
| Index of Refraction | 1.565 |
| InChIKey | JFCPPRNYYLXIGH-UHFFFAOYSA-N |
| SMILES | CC(CCN1CCOCC1)Nc1cc(-c2ccccc2)no1 |
|
~87%
4-Morpholinepro... CAS#:86684-30-2 |
| Literature: Tatee; Kurashige; Shiozawa; Narita; Takei; Ito; Miyazaki; Yamanaka; Mizugaki; Sakamoto Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 4 p. 1634 - 1642 |
|
~%
4-Morpholinepro... CAS#:86684-30-2 |
| Literature: Tatee; Kurashige; Shiozawa; Narita; Takei; Ito; Miyazaki; Yamanaka; Mizugaki; Sakamoto Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 4 p. 1634 - 1642 |
|
~%
4-Morpholinepro... CAS#:86684-30-2 |
| Literature: Tatee; Kurashige; Shiozawa; Narita; Takei; Ito; Miyazaki; Yamanaka; Mizugaki; Sakamoto Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 4 p. 1634 - 1642 |