rac Mono(5-carboxy-2-ethylpentyl) Phthalate-d4 structure
|
Common Name | rac Mono(5-carboxy-2-ethylpentyl) Phthalate-d4 | ||
|---|---|---|---|---|
| CAS Number | 866864-06-4 | Molecular Weight | 312.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16D4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of rac Mono(5-carboxy-2-ethylpentyl) Phthalate-d4Mono(5-carboxy-2-ethylpentyl) phthalate-d4 (MECPP-d4) is a deuterium labeled Mono(5-carboxy-2-ethylpentyl) phthalate (HY-133675). Mono(5-carboxy-2-ethylpentyl) phthalate (MECPP) is a metabolite of Di-(2-ethylhexyl) phthalate (DEHP). Di(2-ethylhexyl) phthalate is the predominant plasticizer added to rigid polyvinyl chloride (PVC) to impart flexibility, temperature tolerance, optical clarity, strength and resistance to kinking[1][2][3]. |
| Name | xfgrnapklgxdgf-knigxjnhsa-n |
|---|
| Description | Mono(5-carboxy-2-ethylpentyl) phthalate-d4 (MECPP-d4) is a deuterium labeled Mono(5-carboxy-2-ethylpentyl) phthalate (HY-133675). Mono(5-carboxy-2-ethylpentyl) phthalate (MECPP) is a metabolite of Di-(2-ethylhexyl) phthalate (DEHP). Di(2-ethylhexyl) phthalate is the predominant plasticizer added to rigid polyvinyl chloride (PVC) to impart flexibility, temperature tolerance, optical clarity, strength and resistance to kinking[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C16H16D4O6 |
|---|---|
| Molecular Weight | 312.35 |
| InChIKey | XFGRNAPKLGXDGF-KNIGXJNHSA-N |
| SMILES | CCC(CCCC(=O)O)COC(=O)c1ccccc1C(=O)O |