2,9-Diazaspiro[5.5]undecane, 2-(phenylmethyl) structure
|
Common Name | 2,9-Diazaspiro[5.5]undecane, 2-(phenylmethyl) | ||
|---|---|---|---|---|
| CAS Number | 867006-13-1 | Molecular Weight | 244.37500 | |
| Density | 1.05g/cm3 | Boiling Point | 357.7ºC at 760 mmHg | |
| Molecular Formula | C16H24N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136ºC | |
| Name | 2-benzyl-2,9-diazaspiro[5.5]undecane,dihydrochloride |
|---|
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 357.7ºC at 760 mmHg |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.37500 |
| Flash Point | 136ºC |
| Exact Mass | 244.19400 |
| PSA | 15.27000 |
| LogP | 2.91890 |
| Index of Refraction | 1.576 |
| InChIKey | IDJZJNREVYBLCJ-UHFFFAOYSA-N |
| SMILES | Cl.Cl.c1ccc(CN2CCCC3(CCNCC3)C2)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |