3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine structure
|
Common Name | 3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine | ||
|---|---|---|---|---|
| CAS Number | 867006-28-8 | Molecular Weight | 277.16700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24BNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Chinese name: 2-甲氧基-3-乙基-5-(4,4,5,5-四甲基-1,3,2-二噁硼烷-2-基)吡啶; English name: 3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine; CAS number: 867006-28-8; Molecular formula: C15H24BNO3; Molecular weight: 277.16700. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H24BNO3 |
|---|---|
| Molecular Weight | 277.16700 |
| Exact Mass | 277.18500 |
| PSA | 40.58000 |
| LogP | 2.26020 |
| InChIKey | KXSJOBWNLLDNBH-UHFFFAOYSA-N |
| SMILES | CCc1cc(B2OC(C)(C)C(C)(C)O2)c(C)nc1OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~80%
3-ethyl-2-metho... CAS#:867006-28-8 |
| Literature: AVENTIS PHARMACEUTICALS INC. Patent: WO2005/97750 A1, 2005 ; Location in patent: Page/Page column 59-60; 105 ; WO 2005/097750 A1 |
|
~75%
3-ethyl-2-metho... CAS#:867006-28-8 |
| Literature: AVENTIS PHARMACEUTICALS INC. Patent: WO2005/97750 A1, 2005 ; Location in patent: Page/Page column 59 ; WO 2005/097750 A1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-[1,3,2]-dioxaborolan-2-yl)pyridine |
| D-1909 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine? |
| A: LogP of 3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is 2.26020. |
| Q: What is the CAS number of 3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine? |
| A: CAS number of 3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is 867006-28-8. |
| Q: What is the SMILES notation of 3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine? |
| A: SMILES notation of 3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is CCc1cc(B2OC(C)(C)C(C)(C)O2)c(C)nc1OC. |
| Q: What is the molecular formula of 3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine? |
| A: Molecular formula of 3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is C15H24BNO3. |
| Q: What is the English name of 3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine? |
| A: The English name of 3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is 3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. |
| Q: What English synonyms does 3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine have? |
| A: English synonyms of 3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine: 3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-[1,3,2]-dioxaborolan-2-yl)pyridine, D-1909. |
| Q: What is the polar surface area (PSA) of 3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine? |
| A: Polar surface area (PSA) of 3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is 40.58000. |
| Q: What are the upstream materials of 3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine? |
| A: Related upstream materials(CAS) of 3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine: 867006-25-5;25015-63-8;73183-34-3. |
| Q: What is the InChIKey of 3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine? |
| A: InChIKey of 3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is KXSJOBWNLLDNBH-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine? |
| A: Molecular weight of 3-ethyl-2-methoxy-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is 277.16700. |