2-[4-(4-Amino-2-fluorophenoxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]ethanol
Modify Date: 2025-11-05 17:23:58
![2-[4-(4-Amino-2-fluorophenoxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]ethanol Structure](https://www.chemsrc.com/extcaspic/387/867018-12-0.png)
2-[4-(4-Amino-2-fluorophenoxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]ethanol structure
|
Common Name | 2-[4-(4-Amino-2-fluorophenoxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]ethanol | ||
|---|---|---|---|---|
| CAS Number | 867018-12-0 | Molecular Weight | 287.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14FN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[4-(4-Amino-2-fluorophenoxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]ethanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H14FN3O2 |
|---|---|
| Molecular Weight | 287.29 |
| InChIKey | RWARLLJTEWPLNR-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Oc2ccnc3[nH]cc(CCO)c23)c(F)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-[4-(4-Amino-2-fluorophenoxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]ethanol? |
| A: The English name of 2-[4-(4-Amino-2-fluorophenoxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]ethanol is 2-[4-(4-Amino-2-fluorophenoxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]ethanol. |
| Q: What is the CAS number of 2-[4-(4-Amino-2-fluorophenoxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]ethanol? |
| A: CAS number of 2-[4-(4-Amino-2-fluorophenoxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]ethanol is 867018-12-0. |
| Q: What is the molecular formula of 2-[4-(4-Amino-2-fluorophenoxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]ethanol? |
| A: Molecular formula of 2-[4-(4-Amino-2-fluorophenoxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]ethanol is C15H14FN3O2. |
| Q: What is the SMILES notation of 2-[4-(4-Amino-2-fluorophenoxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]ethanol? |
| A: SMILES notation of 2-[4-(4-Amino-2-fluorophenoxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]ethanol is Nc1ccc(Oc2ccnc3[nH]cc(CCO)c23)c(F)c1. |
| Q: What is the molecular weight of 2-[4-(4-Amino-2-fluorophenoxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]ethanol? |
| A: Molecular weight of 2-[4-(4-Amino-2-fluorophenoxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]ethanol is 287.29. |
| Q: What is the InChIKey of 2-[4-(4-Amino-2-fluorophenoxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]ethanol? |
| A: InChIKey of 2-[4-(4-Amino-2-fluorophenoxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]ethanol is RWARLLJTEWPLNR-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 867018-12-0? |
| A: Chinese name of 867018-12-0 is 867018-12-0. |