Ethyl 2-(4-(tert-butoxycarbonyl)piperazin-1-yl)thiazole-4-carboxylate structure
|
Common Name | Ethyl 2-(4-(tert-butoxycarbonyl)piperazin-1-yl)thiazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 867065-53-0 | Molecular Weight | 341.426 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 455.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C15H23N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.3±31.5 °C | |
| Name | Ethyl 2-(4-(tert-butoxycarbonyl)piperazin-1-yl)thiazole-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 455.5±55.0 °C at 760 mmHg |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.426 |
| Flash Point | 229.3±31.5 °C |
| Exact Mass | 341.140930 |
| PSA | 100.21000 |
| LogP | 1.44 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | VJUXJZFRSYXDIL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1csc(N2CCN(C(=O)OC(C)(C)C)CC2)n1 |
| HS Code | 2934100090 |
|---|
|
~%
Ethyl 2-(4-(ter... CAS#:867065-53-0 |
| Literature: WO2007/14290 A2, ; Page/Page column 91 ; |
|
~%
Ethyl 2-(4-(ter... CAS#:867065-53-0 |
| Literature: WO2008/91594 A2, ; Page/Page column 108 ; |
|
~%
Ethyl 2-(4-(ter... CAS#:867065-53-0 |
| Literature: WO2008/83238 A2, ; Page/Page column 112 ; WO 2008/083238 A2 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-Methyl-2-propanyl 4-[4-(ethoxycarbonyl)-1,3-thiazol-2-yl]-1-piperazinecarboxylate |
| tert-Butyl 4-[4-(ethoxycarbonyl)-1,3-thiazol-2-yl]piperazine-1-carboxylate |
| 1-Piperazinecarboxylic acid, 4-[4-(ethoxycarbonyl)-2-thiazolyl]-, 1,1-dimethylethyl ester |
| ethyl 2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-1,3-thiazole-4-carboxylate |