[(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 2-[(8-chloronaphthalen-1-yl)sulfanyl]acetate
Modify Date: 2026-07-05 18:29:09
![[(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 2-[(8-chloronaphthalen-1-yl)sulfanyl]acetate Structure](https://www.chemsrc.com/extcaspic/022/867159-24-8.png)
[(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 2-[(8-chloronaphthalen-1-yl)sulfanyl]acetate structure
|
Common Name | [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 2-[(8-chloronaphthalen-1-yl)sulfanyl]acetate | ||
|---|---|---|---|---|
| CAS Number | 867159-24-8 | Molecular Weight | 404.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H21ClN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 2-[(8-chloronaphthalen-1-yl)sulfanyl]acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H21ClN2O3S |
|---|---|
| Molecular Weight | 404.9 |
| InChIKey | LZFJYKUCTFOCKI-UHFFFAOYSA-N |
| SMILES | CC(C)C(C)(C#N)NC(=O)COC(=O)CSc1cccc2cccc(Cl)c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 2-[(8-chloronaphthalen-1-yl)sulfanyl]acetate? |
| A: The English name of [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 2-[(8-chloronaphthalen-1-yl)sulfanyl]acetate is [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 2-[(8-chloronaphthalen-1-yl)sulfanyl]acetate. |
| Q: What is the molecular weight of [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 2-[(8-chloronaphthalen-1-yl)sulfanyl]acetate? |
| A: Molecular weight of [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 2-[(8-chloronaphthalen-1-yl)sulfanyl]acetate is 404.9. |
| Q: What is the SMILES notation of [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 2-[(8-chloronaphthalen-1-yl)sulfanyl]acetate? |
| A: SMILES notation of [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 2-[(8-chloronaphthalen-1-yl)sulfanyl]acetate is CC(C)C(C)(C#N)NC(=O)COC(=O)CSc1cccc2cccc(Cl)c12. |
| Q: What is the CAS number of [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 2-[(8-chloronaphthalen-1-yl)sulfanyl]acetate? |
| A: CAS number of [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 2-[(8-chloronaphthalen-1-yl)sulfanyl]acetate is 867159-24-8. |
| Q: What is the InChIKey of [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 2-[(8-chloronaphthalen-1-yl)sulfanyl]acetate? |
| A: InChIKey of [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 2-[(8-chloronaphthalen-1-yl)sulfanyl]acetate is LZFJYKUCTFOCKI-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 867159-24-8? |
| A: Chinese name of 867159-24-8 is 867159-24-8. |
| Q: What is the molecular formula of [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 2-[(8-chloronaphthalen-1-yl)sulfanyl]acetate? |
| A: Molecular formula of [(1-Cyano-1,2-dimethylpropyl)carbamoyl]methyl 2-[(8-chloronaphthalen-1-yl)sulfanyl]acetate is C20H21ClN2O3S. |